C29H29N3O4 — CID 16964982
1-(1,3-benzodioxol-5-yl)-4-[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 16964982) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 16964982 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-[1-[4-(2-methylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | Cc1ccccc1OCCCCn1c(C2CC(=O)N(c3ccc4c(c3)OCO4)C2)nc2ccccc21 |
| InChI | InChI=1S/C29H29N3O4/c1-20-8-2-5-11-25(20)34-15-7-6-14-31-24-10-4-3-9-23(24)30-29(31)21-16-28(33)32(18-21)22-12-13-26-27(17-22)36-19-35-26/h2-5,8-13,17,21H,6-7,14-16,18-19H2,1H3 |
| InChIKey | YDPGLOKLSVGFQY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|