C26H28N4O3 — CID 16965962
N-[2-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide (PubChem CID 16965962) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[2-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16965962 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[2-[1-[4-(2-methoxyphenoxy)butyl]benzimidazol-2-yl]ethyl]pyridine-4-carboxamide |
| SMILES | COc1ccccc1OCCCCn1c(CCNC(=O)c2ccncc2)nc2ccccc21 |
| InChI | InChI=1S/C26H28N4O3/c1-32-23-10-4-5-11-24(23)33-19-7-6-18-30-22-9-3-2-8-21(22)29-25(30)14-17-28-26(31)20-12-15-27-16-13-20/h2-5,8-13,15-16H,6-7,14,17-19H2,1H3,(H,28,31) |
| InChIKey | FZUOBYNPJSQCPP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|