C23H22N4O3 — CID 16966556
N-[[1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]pyridine-2-carboxamide (PubChem CID 16966556) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[[1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16966556 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[[1-[2-(2-methoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]pyridine-2-carboxamide |
| SMILES | COc1ccccc1OCCn1c(CNC(=O)c2ccccn2)nc2ccccc21 |
| InChI | InChI=1S/C23H22N4O3/c1-29-20-11-4-5-12-21(20)30-15-14-27-19-10-3-2-8-17(19)26-22(27)16-25-23(28)18-9-6-7-13-24-18/h2-13H,14-16H2,1H3,(H,25,28) |
| InChIKey | RGPUPJDFTTZAOU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |