C20H24N4O — CID 16966831
N-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 16966831) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | N-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16966831 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-methyl-N-[(1-pentylbenzimidazol-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | CCCCCn1c(CN(C)C(=O)c2ccccn2)nc2ccccc21 |
| InChI | InChI=1S/C20H24N4O/c1-3-4-9-14-24-18-12-6-5-10-16(18)22-19(24)15-23(2)20(25)17-11-7-8-13-21-17/h5-8,10-13H,3-4,9,14-15H2,1-2H3 |
| InChIKey | BFURTNCWPAYIIW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|