C26H26ClN3O2 — CID 16967691
2-chloro-N-[1-[1-[3-(2-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16967691) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 2-chloro-N-[1-[1-[3-(2-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[1-[1-[3-(2-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16967691 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-chloro-N-[1-[1-[3-(2-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1ccccc1OCCCn1c(C(C)NC(=O)c2ccccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C26H26ClN3O2/c1-18-10-3-8-15-24(18)32-17-9-16-30-23-14-7-6-13-22(23)29-25(30)19(2)28-26(31)20-11-4-5-12-21(20)27/h3-8,10-15,19H,9,16-17H2,1-2H3,(H,28,31) |
| InChIKey | OPZUNSGYRSWZGY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|