C26H35N3O — CID 16967790
2,4-dimethyl-N-[1-(1-octylbenzimidazol-2-yl)ethyl]benzamide (PubChem CID 16967790) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 2,4-dimethyl-N-[1-(1-octylbenzimidazol-2-yl)ethyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[1-(1-octylbenzimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 16967790 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 2,4-dimethyl-N-[1-(1-octylbenzimidazol-2-yl)ethyl]benzamide |
| SMILES | CCCCCCCCn1c(C(C)NC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C26H35N3O/c1-5-6-7-8-9-12-17-29-24-14-11-10-13-23(24)28-25(29)21(4)27-26(30)22-16-15-19(2)18-20(22)3/h10-11,13-16,18,21H,5-9,12,17H2,1-4H3,(H,27,30) |
| InChIKey | MOIPIIDFFHMYAQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|