C21H25N3O2 — CID 16968736
N-[1-[1-[(2-methoxyphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide (PubChem CID 16968736) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[1-[1-[(2-methoxyphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide.
| Compound Name | N-[1-[1-[(2-methoxyphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 16968736 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[1-[1-[(2-methoxyphenyl)methyl]benzimidazol-2-yl]ethyl]butanamide |
| SMILES | CCCC(=O)NC(C)c1nc2ccccc2n1Cc1ccccc1OC |
| InChI | InChI=1S/C21H25N3O2/c1-4-9-20(25)22-15(2)21-23-17-11-6-7-12-18(17)24(21)14-16-10-5-8-13-19(16)26-3/h5-8,10-13,15H,4,9,14H2,1-3H3,(H,22,25) |
| InChIKey | MZPDGBBIEMMTJJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |