C27H37N3O2 — CID 16969578
N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-2,2-dimethylpropanamide (PubChem CID 16969578) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16969578 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | N-[[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCc1nc2ccccc2n1CCCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37N3O2/c1-26(2,3)20-13-15-21(16-14-20)32-18-10-9-17-30-23-12-8-7-11-22(23)29-24(30)19-28-25(31)27(4,5)6/h7-8,11-16H,9-10,17-19H2,1-6H3,(H,28,31) |
| InChIKey | LMQHPYQJRPZDJH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|