C22H25N3O3 — CID 16969834
N-[[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]cyclopropanecarboxamide (PubChem CID 16969834) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 16969834 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]methyl]cyclopropanecarboxamide |
| SMILES | CCOc1ccccc1OCCn1c(CNC(=O)C2CC2)nc2ccccc21 |
| InChI | InChI=1S/C22H25N3O3/c1-2-27-19-9-5-6-10-20(19)28-14-13-25-18-8-4-3-7-17(18)24-21(25)15-23-22(26)16-11-12-16/h3-10,16H,2,11-15H2,1H3,(H,23,26) |
| InChIKey | XUZREGFRZAZEML-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |