About 5,6-dianilinoisoindole-1,3-dione
5,6-dianilinoisoindole-1,3-dione (PubChem CID 1697) has the molecular formula C20H15N3O2
and a molecular weight of 329.36 g/mol. Its IUPAC name is 5,6-dianilinoisoindole-1,3-dione.
Molecular Properties
| Compound Name | 5,6-dianilinoisoindole-1,3-dione |
| PubChem CID | 1697 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 5,6-dianilinoisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Nc3ccccc3)c(Nc3ccccc3)cc21 |
| InChI | InChI=1S/C20H15N3O2/c24-19-15-11-17(21-13-7-3-1-4-8-13)18(12-16(15)20(25)23-19)22-14-9-5-2-6-10-14/h1-12,21-22H,(H,23,24,25) |
| InChIKey | AAALVYBICLMAMA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dianilinoisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dianilinoisoindole-1,3-dione?
The IUPAC name of 5,6-dianilinoisoindole-1,3-dione (CID 1697) is 5,6-dianilinoisoindole-1,3-dione.
What is the SMILES notation for 5,6-dianilinoisoindole-1,3-dione?
The canonical SMILES for 5,6-dianilinoisoindole-1,3-dione is O=C1NC(=O)c2cc(Nc3ccccc3)c(Nc3ccccc3)cc21.
What is the InChIKey of 5,6-dianilinoisoindole-1,3-dione?
The InChIKey is AAALVYBICLMAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2/c24-19-15-11-17(21-13-7-3-1-4-8-13)18(12-16(15)20(25)23-19)22-14-9-5-2-6-10-14/h1-12,21-22H,(H,23,24,25).
What are the key properties of 5,6-dianilinoisoindole-1,3-dione?
5,6-dianilinoisoindole-1,3-dione has a molecular weight of 329.36 g/mol, XLogP of 4.06, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dianilinoisoindole-1,3-dione is sourced from PubChem (CID 1697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).