C22H26ClN3O — CID 16972996
2-(4-chlorophenyl)-N-[1-[1-(2-methylbutyl)benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16972996) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-[1-(2-methylbutyl)benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-[1-(2-methylbutyl)benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16972996 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-[1-(2-methylbutyl)benzimidazol-2-yl]ethyl]acetamide |
| SMILES | CCC(C)Cn1c(C(C)NC(=O)Cc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C22H26ClN3O/c1-4-15(2)14-26-20-8-6-5-7-19(20)25-22(26)16(3)24-21(27)13-17-9-11-18(23)12-10-17/h5-12,15-16H,4,13-14H2,1-3H3,(H,24,27) |
| InChIKey | ONXORCDUJOXDQN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |