C24H36N4O2 — CID 16975107
N-[2-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide (PubChem CID 16975107) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[2-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16975107 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | N-[2-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
| SMILES | CCCN(CCC)C(=O)Cn1c(CCNC(=O)C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C24H36N4O2/c1-3-16-27(17-4-2)23(29)18-28-21-13-9-8-12-20(21)26-22(28)14-15-25-24(30)19-10-6-5-7-11-19/h8-9,12-13,19H,3-7,10-11,14-18H2,1-2H3,(H,25,30) |
| InChIKey | QAFAZDYNGXMWEN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |