C24H25N3O4 — CID 16975480
N-[2-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 16975480) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[2-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16975480 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[2-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | CCOc1ccccc1OCCn1c(CCNC(=O)c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C24H25N3O4/c1-2-29-20-10-5-6-11-21(20)31-17-15-27-19-9-4-3-8-18(19)26-23(27)13-14-25-24(28)22-12-7-16-30-22/h3-12,16H,2,13-15,17H2,1H3,(H,25,28) |
| InChIKey | MJMNDPYDUOAFPY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |