C29H32ClN3O2 — CID 16976138
2-chloro-N-[2-[1-[4-(2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16976138) has the molecular formula C29H32ClN3O2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[4-(2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-[4-(2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16976138 |
| Molecular Formula | C29H32ClN3O2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-chloro-N-[2-[1-[4-(2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CC(C)c1ccccc1OCCCCn1c(CCNC(=O)c2ccccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C29H32ClN3O2/c1-21(2)22-11-4-8-16-27(22)35-20-10-9-19-33-26-15-7-6-14-25(26)32-28(33)17-18-31-29(34)23-12-3-5-13-24(23)30/h3-8,11-16,21H,9-10,17-20H2,1-2H3,(H,31,34) |
| InChIKey | LFQKIZLSTSCBHM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|