C26H33N3O2 — CID 16981715
N-[3-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]cyclopropanecarboxamide (PubChem CID 16981715) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[3-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 16981715 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | N-[3-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]cyclopropanecarboxamide |
| SMILES | Cc1cccc(C)c1OCCCCn1c(CCCNC(=O)C2CC2)nc2ccccc21 |
| InChI | InChI=1S/C26H33N3O2/c1-19-9-7-10-20(2)25(19)31-18-6-5-17-29-23-12-4-3-11-22(23)28-24(29)13-8-16-27-26(30)21-14-15-21/h3-4,7,9-12,21H,5-6,8,13-18H2,1-2H3,(H,27,30) |
| InChIKey | RYKCYGHLNRWIFQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|