C18H19N3O4 — CID 16982030
methyl 2-[2-[3-(furan-2-carbonylamino)propyl]benzimidazol-1-yl]acetate (PubChem CID 16982030) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is methyl 2-[2-[3-(furan-2-carbonylamino)propyl]benzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-[3-(furan-2-carbonylamino)propyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16982030 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl 2-[2-[3-(furan-2-carbonylamino)propyl]benzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(CCCNC(=O)c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C18H19N3O4/c1-24-17(22)12-21-14-7-3-2-6-13(14)20-16(21)9-4-10-19-18(23)15-8-5-11-25-15/h2-3,5-8,11H,4,9-10,12H2,1H3,(H,19,23) |
| InChIKey | UWMFGSDIQHVKBU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|