C28H31N3O3 — CID 16982302
N-[3-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16982302) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[3-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | N-[3-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16982302 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[3-[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | COc1ccc(OCCCCn2c(CCCNC(=O)c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-33-23-15-17-24(18-16-23)34-21-8-7-20-31-26-13-6-5-12-25(26)30-27(31)14-9-19-29-28(32)22-10-3-2-4-11-22/h2-6,10-13,15-18H,7-9,14,19-21H2,1H3,(H,29,32) |
| InChIKey | HRKPONGGFDARKQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|