C27H27N3O2 — CID 16983669
3-methoxy-N-[3-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16983669) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-methoxy-N-[3-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 3-methoxy-N-[3-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16983669 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-methoxy-N-[3-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCCc2nc3ccccc3n2C/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C27H27N3O2/c1-32-23-14-7-13-22(20-23)27(31)28-18-8-17-26-29-24-15-5-6-16-25(24)30(26)19-9-12-21-10-3-2-4-11-21/h2-7,9-16,20H,8,17-19H2,1H3,(H,28,31)/b12-9+ |
| InChIKey | VRQRYZUNQNXADU-FMIVXFBMSA-N |
| XLogP | 5.12 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|