C28H30N4O3 — CID 16984221
N-[3-[1-[2-(N-ethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-4-methoxybenzamide (PubChem CID 16984221) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[3-[1-[2-(N-ethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-4-methoxybenzamide.
| Compound Name | N-[3-[1-[2-(N-ethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 16984221 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[3-[1-[2-(N-ethylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-4-methoxybenzamide |
| SMILES | CCN(C(=O)Cn1c(CCCNC(=O)c2ccc(OC)cc2)nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C28H30N4O3/c1-3-31(22-10-5-4-6-11-22)27(33)20-32-25-13-8-7-12-24(25)30-26(32)14-9-19-29-28(34)21-15-17-23(35-2)18-16-21/h4-8,10-13,15-18H,3,9,14,19-20H2,1-2H3,(H,29,34) |
| InChIKey | VVBJXQSXQJENGQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|