C30H27N3O — CID 16987485
N-benzyl-N-methyl-2-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]acetamide (PubChem CID 16987485) has the molecular formula C30H27N3O and a molecular weight of 445.57 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]acetamide.
| Compound Name | N-benzyl-N-methyl-2-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 16987485 |
| Molecular Formula | C30H27N3O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-benzyl-N-methyl-2-[2-[(4-phenylphenyl)methyl]benzimidazol-1-yl]acetamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cn1c(Cc2ccc(-c3ccccc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C30H27N3O/c1-32(21-24-10-4-2-5-11-24)30(34)22-33-28-15-9-8-14-27(28)31-29(33)20-23-16-18-26(19-17-23)25-12-6-3-7-13-25/h2-19H,20-22H2,1H3 |
| InChIKey | NNRCPYKHWXNSPU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |