C29H33N3O2 — CID 16996383
N-cyclohexyl-2-[2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazol-1-yl]-N-methylacetamide (PubChem CID 16996383) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazol-1-yl]-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-[2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 16996383 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-cyclohexyl-2-[2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazol-1-yl]-N-methylacetamide |
| SMILES | COc1ccc2cc(C(C)c3nc4ccccc4n3CC(=O)N(C)C3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C29H33N3O2/c1-20(21-13-14-23-18-25(34-3)16-15-22(23)17-21)29-30-26-11-7-8-12-27(26)32(29)19-28(33)31(2)24-9-5-4-6-10-24/h7-8,11-18,20,24H,4-6,9-10,19H2,1-3H3 |
| InChIKey | VKKQAMHZNHEASR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |