C24H23ClN2O — CID 16999090
2-[1-(4-chloro-3-methylphenoxy)ethyl]-1-[(3-methylphenyl)methyl]benzimidazole (PubChem CID 16999090) has the molecular formula C24H23ClN2O and a molecular weight of 390.91 g/mol. Its IUPAC name is 2-[1-(4-chloro-3-methylphenoxy)ethyl]-1-[(3-methylphenyl)methyl]benzimidazole.
| Compound Name | 2-[1-(4-chloro-3-methylphenoxy)ethyl]-1-[(3-methylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 16999090 |
| Molecular Formula | C24H23ClN2O |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-[1-(4-chloro-3-methylphenoxy)ethyl]-1-[(3-methylphenyl)methyl]benzimidazole |
| SMILES | Cc1cccc(Cn2c(C(C)Oc3ccc(Cl)c(C)c3)nc3ccccc32)c1 |
| InChI | InChI=1S/C24H23ClN2O/c1-16-7-6-8-19(13-16)15-27-23-10-5-4-9-22(23)26-24(27)18(3)28-20-11-12-21(25)17(2)14-20/h4-14,18H,15H2,1-3H3 |
| InChIKey | KGOIYFLVVDRNCM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |