About 3,4-dihydro-2H-thiepino[4,5-b]pyran
3,4-dihydro-2H-thiepino[4,5-b]pyran (PubChem CID 170000410) has the molecular formula C9H10OS
and a molecular weight of 166.25 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiepino[4,5-b]pyran.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-thiepino[4,5-b]pyran |
| PubChem CID | 170000410 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3,4-dihydro-2H-thiepino[4,5-b]pyran |
| SMILES | C1=CC2=C(C=CS1)OCCC2 |
| InChI | InChI=1S/C9H10OS/c1-2-8-3-6-11-7-4-9(8)10-5-1/h3-4,6-7H,1-2,5H2 |
| InChIKey | LGKPABZIVRXPJB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-thiepino[4,5-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-thiepino[4,5-b]pyran?
The IUPAC name of 3,4-dihydro-2H-thiepino[4,5-b]pyran (CID 170000410) is 3,4-dihydro-2H-thiepino[4,5-b]pyran.
What is the SMILES notation for 3,4-dihydro-2H-thiepino[4,5-b]pyran?
The canonical SMILES for 3,4-dihydro-2H-thiepino[4,5-b]pyran is C1=CC2=C(C=CS1)OCCC2.
What is the InChIKey of 3,4-dihydro-2H-thiepino[4,5-b]pyran?
The InChIKey is LGKPABZIVRXPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-2-8-3-6-11-7-4-9(8)10-5-1/h3-4,6-7H,1-2,5H2.
What are the key properties of 3,4-dihydro-2H-thiepino[4,5-b]pyran?
3,4-dihydro-2H-thiepino[4,5-b]pyran has a molecular weight of 166.25 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-thiepino[4,5-b]pyran is sourced from PubChem (CID 170000410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).