About 7'-bromospiro[cyclobutane-1,1'-indene]
7'-bromospiro[cyclobutane-1,1'-indene] (PubChem CID 170000889) has the molecular formula C12H11Br
and a molecular weight of 235.12 g/mol. Its IUPAC name is 7'-bromospiro[cyclobutane-1,1'-indene].
Molecular Properties
| Compound Name | 7'-bromospiro[cyclobutane-1,1'-indene] |
| PubChem CID | 170000889 |
| Molecular Formula | C12H11Br |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 7'-bromospiro[cyclobutane-1,1'-indene] |
| SMILES | Brc1cccc2c1C1(C=C2)CCC1 |
| InChI | InChI=1S/C12H11Br/c13-10-4-1-3-9-5-8-12(11(9)10)6-2-7-12/h1,3-5,8H,2,6-7H2 |
| InChIKey | CNFOLRNWKWSERT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7'-bromospiro[cyclobutane-1,1'-indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-bromospiro[cyclobutane-1,1'-indene]?
The IUPAC name of 7'-bromospiro[cyclobutane-1,1'-indene] (CID 170000889) is 7'-bromospiro[cyclobutane-1,1'-indene].
What is the SMILES notation for 7'-bromospiro[cyclobutane-1,1'-indene]?
The canonical SMILES for 7'-bromospiro[cyclobutane-1,1'-indene] is Brc1cccc2c1C1(C=C2)CCC1.
What is the InChIKey of 7'-bromospiro[cyclobutane-1,1'-indene]?
The InChIKey is CNFOLRNWKWSERT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Br/c13-10-4-1-3-9-5-8-12(11(9)10)6-2-7-12/h1,3-5,8H,2,6-7H2.
What are the key properties of 7'-bromospiro[cyclobutane-1,1'-indene]?
7'-bromospiro[cyclobutane-1,1'-indene] has a molecular weight of 235.12 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-bromospiro[cyclobutane-1,1'-indene] is sourced from PubChem (CID 170000889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).