C26H32NO2S+ — CID 170001024
2-[3-[1-(5,7-dimethyl-3,5-dihydro-2H-1,4-dioxepin-2-yl)propyl]-1-benzothiophen-2-yl]-1-propylpyridin-1-ium (PubChem CID 170001024) has the molecular formula C26H32NO2S+ and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[3-[1-(5,7-dimethyl-3,5-dihydro-2H-1,4-dioxepin-2-yl)propyl]-1-benzothiophen-2-yl]-1-propylpyridin-1-ium.
| Compound Name | 2-[3-[1-(5,7-dimethyl-3,5-dihydro-2H-1,4-dioxepin-2-yl)propyl]-1-benzothiophen-2-yl]-1-propylpyridin-1-ium |
|---|---|
| PubChem CID | 170001024 |
| Molecular Formula | C26H32NO2S+ |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[3-[1-(5,7-dimethyl-3,5-dihydro-2H-1,4-dioxepin-2-yl)propyl]-1-benzothiophen-2-yl]-1-propylpyridin-1-ium |
| SMILES | CCC[n+]1ccccc1-c1sc2ccccc2c1C(CC)C1COC(C)C=C(C)O1 |
| InChI | InChI=1S/C26H32NO2S/c1-5-14-27-15-10-9-12-22(27)26-25(21-11-7-8-13-24(21)30-26)20(6-2)23-17-28-18(3)16-19(4)29-23/h7-13,15-16,18,20,23H,5-6,14,17H2,1-4H3/q+1 |
| InChIKey | VVMKMSCMGOEBAU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|