C24H22ClFN6O2 — CID 170001362
(2E,3E,5Z)-2-[[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-1-methylpyrazol-5-yl]methylidene]-5-chloro-6-fluoro-3-[(1S,2S)-2-methylcyclopropyl]oxyhexa-3,5-dienenitrile (PubChem CID 170001362) has the molecular formula C24H22ClFN6O2 and a molecular weight of 480.93 g/mol. Its IUPAC name is (2E,3E,5Z)-2-[[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-1-methylpyrazol-5-yl]methylidene]-5-chloro-6-fluoro-3-[(1S,2S)-2-methylcyclopropyl]oxyhexa-3,5-dienenitrile.
| Compound Name | (2E,3E,5Z)-2-[[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-1-methylpyrazol-5-yl]methylidene]-5-chloro-6-fluoro-3-[(1S,2S)-2-methylcyclopropyl]oxyhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 170001362 |
| Molecular Formula | C24H22ClFN6O2 |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (2E,3E,5Z)-2-[[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-1-methylpyrazol-5-yl]methylidene]-5-chloro-6-fluoro-3-[(1S,2S)-2-methylcyclopropyl]oxyhexa-3,5-dienenitrile |
| SMILES | C[C@H]1C[C@@H]1OC(=C/C(Cl)=C/F)/C(C#N)=C/c1c(-c2ccc3c(=O)[nH]nc(CN)c3c2)cnn1C |
| InChI | InChI=1S/C24H22ClFN6O2/c1-13-5-22(13)34-23(8-16(25)9-26)15(10-27)7-21-19(12-29-32(21)2)14-3-4-17-18(6-14)20(11-28)30-31-24(17)33/h3-4,6-9,12-13,22H,5,11,28H2,1-2H3,(H,31,33)/b15-7+,16-9-,23-8+/t13-,22-/m0/s1 |
| InChIKey | DWVPXZHWQGNCEJ-RVCANTMXSA-N |
| XLogP | 4.05 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|