C20H22F2N6O — CID 170001366
8-fluoro-7-[[4-[6-[[fluoro(methyl)amino]methyl]-3-pyridinyl]piperazin-1-yl]methyl]-1H-quinoxalin-2-one (PubChem CID 170001366) has the molecular formula C20H22F2N6O and a molecular weight of 400.43 g/mol. Its IUPAC name is 8-fluoro-7-[[4-[6-[[fluoro(methyl)amino]methyl]-3-pyridinyl]piperazin-1-yl]methyl]-1H-quinoxalin-2-one.
| Compound Name | 8-fluoro-7-[[4-[6-[[fluoro(methyl)amino]methyl]-3-pyridinyl]piperazin-1-yl]methyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 170001366 |
| Molecular Formula | C20H22F2N6O |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 8-fluoro-7-[[4-[6-[[fluoro(methyl)amino]methyl]-3-pyridinyl]piperazin-1-yl]methyl]-1H-quinoxalin-2-one |
| SMILES | CN(F)Cc1ccc(N2CCN(Cc3ccc4ncc(=O)[nH]c4c3F)CC2)cn1 |
| InChI | InChI=1S/C20H22F2N6O/c1-26(22)13-15-3-4-16(10-23-15)28-8-6-27(7-9-28)12-14-2-5-17-20(19(14)21)25-18(29)11-24-17/h2-5,10-11H,6-9,12-13H2,1H3,(H,25,29) |
| InChIKey | KBTXJFHEPROYPA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|