About 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium
2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium (PubChem CID 170001717) has the molecular formula C17H26N2O2P+
and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium.
Molecular Properties
| Compound Name | 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium |
| PubChem CID | 170001717 |
| Molecular Formula | C17H26N2O2P+ |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium |
| SMILES | CC(C)c1ccc2nc(C(C)C)n(C(C)(C)O[P+](C)=O)c2c1 |
| InChI | InChI=1S/C17H26N2O2P/c1-11(2)13-8-9-14-15(10-13)19(16(18-14)12(3)4)17(5,6)21-22(7)20/h8-12H,1-7H3/q+1 |
| InChIKey | CMMQJMQLASWOPC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium?
The IUPAC name of 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium (CID 170001717) is 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium.
What is the SMILES notation for 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium?
The canonical SMILES for 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium is CC(C)c1ccc2nc(C(C)C)n(C(C)(C)O[P+](C)=O)c2c1.
What is the InChIKey of 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium?
The InChIKey is CMMQJMQLASWOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2P/c1-11(2)13-8-9-14-15(10-13)19(16(18-14)12(3)4)17(5,6)21-22(7)20/h8-12H,1-7H3/q+1.
What are the key properties of 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium?
2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium has a molecular weight of 321.38 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-di(propan-2-yl)benzimidazol-1-yl]propan-2-yloxy-methyl-oxophosphanium is sourced from PubChem (CID 170001717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).