C23H22FN5O4 — CID 170002131
10-fluoro-11-methyl-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one (PubChem CID 170002131) has the molecular formula C23H22FN5O4 and a molecular weight of 451.46 g/mol. Its IUPAC name is 10-fluoro-11-methyl-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one.
| Compound Name | 10-fluoro-11-methyl-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
|---|---|
| PubChem CID | 170002131 |
| Molecular Formula | C23H22FN5O4 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 10-fluoro-11-methyl-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
| SMILES | Cc1c(F)cc2cc1COCCCCNC(=O)c1ccc(c([N+](=O)[O-])c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C23H22FN5O4/c1-14-16-10-17(12-19(14)24)27-23-26-8-6-20(28-23)18-5-4-15(11-21(18)29(31)32)22(30)25-7-2-3-9-33-13-16/h4-6,8,10-12H,2-3,7,9,13H2,1H3,(H,25,30)(H,26,27,28) |
| InChIKey | YZWVIVAHDZOTRK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|