C11H15P — CID 170002803
methyl(5,6,7,8-tetrahydronaphthalen-1-yl)phosphane (PubChem CID 170002803) has the molecular formula C11H15P and a molecular weight of 178.22 g/mol. Its IUPAC name is methyl(5,6,7,8-tetrahydronaphthalen-1-yl)phosphane.
| Compound Name | methyl(5,6,7,8-tetrahydronaphthalen-1-yl)phosphane |
|---|---|
| PubChem CID | 170002803 |
| Molecular Formula | C11H15P |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | methyl(5,6,7,8-tetrahydronaphthalen-1-yl)phosphane |
| SMILES | CPc1cccc2c1CCCC2 |
| InChI | InChI=1S/C11H15P/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h4,6,8,12H,2-3,5,7H2,1H3 |
| InChIKey | JSNWIOUXSVPEGF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|