C35H47N7O7 — CID 170003207
2-[13-[4-[2-(2-methoxyethoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-5-yl]ethyl N-[5-(methylamino)-6-oxoheptyl]carbamate (PubChem CID 170003207) has the molecular formula C35H47N7O7 and a molecular weight of 677.80 g/mol. Its IUPAC name is 2-[13-[4-[2-(2-methoxyethoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-5-yl]ethyl N-[5-(methylamino)-6-oxoheptyl]carbamate.
| Compound Name | 2-[13-[4-[2-(2-methoxyethoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-5-yl]ethyl N-[5-(methylamino)-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 170003207 |
| Molecular Formula | C35H47N7O7 |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.35 |
| IUPAC Name | 2-[13-[4-[2-(2-methoxyethoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-5-yl]ethyl N-[5-(methylamino)-6-oxoheptyl]carbamate |
| SMILES | CNC(CCCCNC(=O)OCCn1nnc2c1-c1ccccc1N(C(=O)CCC(=O)NCCOCCOC)Cc1ccccc1-2)C(C)=O |
| InChI | InChI=1S/C35H47N7O7/c1-25(43)29(36-2)13-8-9-17-38-35(46)49-21-19-42-34-28-12-6-7-14-30(28)41(24-26-10-4-5-11-27(26)33(34)39-40-42)32(45)16-15-31(44)37-18-20-48-23-22-47-3/h4-7,10-12,14,29,36H,8-9,13,15-24H2,1-3H3,(H,37,44)(H,38,46) |
| InChIKey | UTDBMEOMPKHMNF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|