C48H46N2 — CID 170003265
N-cyclohexa-1,3-dien-1-yl-9-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-[4-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)phenyl]-2,3-dihydrocarbazol-2-amine (PubChem CID 170003265) has the molecular formula C48H46N2 and a molecular weight of 650.91 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-9-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-[4-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)phenyl]-2,3-dihydrocarbazol-2-amine.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-9-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-[4-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)phenyl]-2,3-dihydrocarbazol-2-amine |
|---|---|
| PubChem CID | 170003265 |
| Molecular Formula | C48H46N2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-9-(4-cyclohexa-1,3-dien-1-ylphenyl)-N-[4-(4-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)phenyl]-2,3-dihydrocarbazol-2-amine |
| SMILES | C1=CCCC(c2ccc(-n3c4c(c5ccccc53)=CCC(N(C3=CC=CCC3)c3ccc(C5=CC=C(C6CC=CCC6)CC5)cc3)C=4)cc2)=C1 |
| InChI | InChI=1S/C48H46N2/c1-4-12-35(13-5-1)37-20-22-38(23-21-37)40-24-28-42(29-25-40)49(41-16-8-3-9-17-41)44-32-33-46-45-18-10-11-19-47(45)50(48(46)34-44)43-30-26-39(27-31-43)36-14-6-2-7-15-36/h1-4,6,8,10-11,14,16,18-20,22,24-31,33-35,44H,5,7,9,12-13,15,17,21,23,32H2 |
| InChIKey | BVGRVBALVIEVGM-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|