C19H24F2N4O2 — CID 170003394
N-[(3S,5R)-1-[7-[amino(hydroxy)methyl]-5-fluoro-2,3-dimethyl-1H-indol-4-yl]-5-fluoropiperidin-3-yl]prop-2-enamide (PubChem CID 170003394) has the molecular formula C19H24F2N4O2 and a molecular weight of 378.42 g/mol. Its IUPAC name is N-[(3S,5R)-1-[7-[amino(hydroxy)methyl]-5-fluoro-2,3-dimethyl-1H-indol-4-yl]-5-fluoropiperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,5R)-1-[7-[amino(hydroxy)methyl]-5-fluoro-2,3-dimethyl-1H-indol-4-yl]-5-fluoropiperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170003394 |
| Molecular Formula | C19H24F2N4O2 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[(3S,5R)-1-[7-[amino(hydroxy)methyl]-5-fluoro-2,3-dimethyl-1H-indol-4-yl]-5-fluoropiperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1C[C@@H](F)CN(c2c(F)cc(C(N)O)c3[nH]c(C)c(C)c23)C1 |
| InChI | InChI=1S/C19H24F2N4O2/c1-4-15(26)24-12-5-11(20)7-25(8-12)18-14(21)6-13(19(22)27)17-16(18)9(2)10(3)23-17/h4,6,11-12,19,23,27H,1,5,7-8,22H2,2-3H3,(H,24,26)/t11-,12+,19?/m1/s1 |
| InChIKey | AFMFXBSLBIKRMI-XJSDQGQKSA-N |
| XLogP | 2.09 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|