C55H35N3 — CID 170003614
2-[4-[4-(2-fluoranthen-3-ylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 170003614) has the molecular formula C55H35N3 and a molecular weight of 737.91 g/mol. Its IUPAC name is 2-[4-[4-(2-fluoranthen-3-ylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-(2-fluoranthen-3-ylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170003614 |
| Molecular Formula | C55H35N3 |
| Molecular Weight | 737.91 g/mol |
| Exact Mass | 737.28 |
| IUPAC Name | 2-[4-[4-(2-fluoranthen-3-ylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc(-c6ccccc6-c6ccc7c8c(cccc68)-c6ccccc6-7)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C55H35N3/c1-3-12-36(13-4-1)37-24-30-42(31-25-37)54-56-53(41-14-5-2-6-15-41)57-55(58-54)43-32-26-39(27-33-43)38-22-28-40(29-23-38)44-16-7-8-17-45(44)48-34-35-51-47-19-10-9-18-46(47)49-20-11-21-50(48)52(49)51/h1-35H |
| InChIKey | OKRFYGZJIIUPJK-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.91 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |