C22H19F2N5O4 — CID 170004233
10,11-difluoro-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one (PubChem CID 170004233) has the molecular formula C22H19F2N5O4 and a molecular weight of 455.42 g/mol. Its IUPAC name is 10,11-difluoro-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one.
| Compound Name | 10,11-difluoro-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
|---|---|
| PubChem CID | 170004233 |
| Molecular Formula | C22H19F2N5O4 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 10,11-difluoro-23-nitro-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
| SMILES | O=C1NCCCCOCc2cc(cc(F)c2F)Nc2nccc(n2)-c2ccc1cc2[N+](=O)[O-] |
| InChI | InChI=1S/C22H19F2N5O4/c23-17-11-15-9-14(20(17)24)12-33-8-2-1-6-25-21(30)13-3-4-16(19(10-13)29(31)32)18-5-7-26-22(27-15)28-18/h3-5,7,9-11H,1-2,6,8,12H2,(H,25,30)(H,26,27,28) |
| InChIKey | LMVCDDVGAQLPTI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|