C25H25FN6O — CID 170004519
(7R)-7-ethyl-2-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5,6-dihydrocyclopenta[b]pyridin-7-ol (PubChem CID 170004519) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is (7R)-7-ethyl-2-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5,6-dihydrocyclopenta[b]pyridin-7-ol.
| Compound Name | (7R)-7-ethyl-2-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5,6-dihydrocyclopenta[b]pyridin-7-ol |
|---|---|
| PubChem CID | 170004519 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (7R)-7-ethyl-2-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| SMILES | CC[C@@]1(O)CCc2ccc(-n3cc(F)c4cnc(Nc5ccc6c(c5)CCNC6)nc43)nc21 |
| InChI | InChI=1S/C25H25FN6O/c1-2-25(33)9-7-15-4-6-21(30-22(15)25)32-14-20(26)19-13-28-24(31-23(19)32)29-18-5-3-17-12-27-10-8-16(17)11-18/h3-6,11,13-14,27,33H,2,7-10,12H2,1H3,(H,28,29,31)/t25-/m1/s1 |
| InChIKey | UMNLZXUAVHFPCQ-RUZDIDTESA-N |
| XLogP | 3.89 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |