About propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate
propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate (PubChem CID 170005298) has the molecular formula C15H24N4O5
and a molecular weight of 340.38 g/mol. Its IUPAC name is propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate |
| PubChem CID | 170005298 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)CCNc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C15H24N4O5/c1-10(2)24-14(22)6-8-17-12(20)5-7-16-11-9-13(21)19(4)15(23)18(11)3/h9-10,16H,5-8H2,1-4H3,(H,17,20) |
| InChIKey | PCIHMJQNCGFNEV-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate?
The IUPAC name of propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate (CID 170005298) is propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate.
What is the SMILES notation for propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate?
The canonical SMILES for propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate is CC(C)OC(=O)CCNC(=O)CCNc1cc(=O)n(C)c(=O)n1C.
What is the InChIKey of propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate?
The InChIKey is PCIHMJQNCGFNEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O5/c1-10(2)24-14(22)6-8-17-12(20)5-7-16-11-9-13(21)19(4)15(23)18(11)3/h9-10,16H,5-8H2,1-4H3,(H,17,20).
What are the key properties of propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate?
propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate has a molecular weight of 340.38 g/mol, XLogP of -0.66, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-[3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]propanoylamino]propanoate is sourced from PubChem (CID 170005298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).