About 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine
2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine (PubChem CID 170005542) has the molecular formula C15H31FN2
and a molecular weight of 258.43 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine.
Molecular Properties
| Compound Name | 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine |
| PubChem CID | 170005542 |
| Molecular Formula | C15H31FN2 |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine |
| SMILES | C=C(NCC(F)C(C)CCCNC(C)C)C(C)C |
| InChI | InChI=1S/C15H31FN2/c1-11(2)14(6)18-10-15(16)13(5)8-7-9-17-12(3)4/h11-13,15,17-18H,6-10H2,1-5H3 |
| InChIKey | IVYGUCHYBSWLDF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine?
The IUPAC name of 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine (CID 170005542) is 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine.
What is the SMILES notation for 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine?
The canonical SMILES for 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine is C=C(NCC(F)C(C)CCCNC(C)C)C(C)C.
What is the InChIKey of 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine?
The InChIKey is IVYGUCHYBSWLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31FN2/c1-11(2)14(6)18-10-15(16)13(5)8-7-9-17-12(3)4/h11-13,15,17-18H,6-10H2,1-5H3.
What are the key properties of 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine?
2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine has a molecular weight of 258.43 g/mol, XLogP of 3.50, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-methyl-N-(3-methylbut-1-en-2-yl)-N'-propan-2-ylhexane-1,6-diamine is sourced from PubChem (CID 170005542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).