About 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene
2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 170005770) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene.
Molecular Properties
| Compound Name | 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene |
| PubChem CID | 170005770 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | CC(C)c1cc(F)c2c(c1F)CC2 |
| InChI | InChI=1S/C11H12F2/c1-6(2)9-5-10(12)7-3-4-8(7)11(9)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | PZIRXXLAYOSTIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene?
The IUPAC name of 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene (CID 170005770) is 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene.
What is the SMILES notation for 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene?
The canonical SMILES for 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene is CC(C)c1cc(F)c2c(c1F)CC2.
What is the InChIKey of 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene?
The InChIKey is PZIRXXLAYOSTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2/c1-6(2)9-5-10(12)7-3-4-8(7)11(9)13/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene?
2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene has a molecular weight of 182.21 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-3-propan-2-ylbicyclo[4.2.0]octa-1,3,5-triene is sourced from PubChem (CID 170005770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).