C24H47N3O2 — CID 170006192
2-methyl-N-[3-[2-[4-(2-propylpentyl)piperazin-1-yl]ethoxy]cyclobutyl]pentanamide (PubChem CID 170006192) has the molecular formula C24H47N3O2 and a molecular weight of 409.66 g/mol. Its IUPAC name is 2-methyl-N-[3-[2-[4-(2-propylpentyl)piperazin-1-yl]ethoxy]cyclobutyl]pentanamide.
| Compound Name | 2-methyl-N-[3-[2-[4-(2-propylpentyl)piperazin-1-yl]ethoxy]cyclobutyl]pentanamide |
|---|---|
| PubChem CID | 170006192 |
| Molecular Formula | C24H47N3O2 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.37 |
| IUPAC Name | 2-methyl-N-[3-[2-[4-(2-propylpentyl)piperazin-1-yl]ethoxy]cyclobutyl]pentanamide |
| SMILES | CCCC(CCC)CN1CCN(CCOC2CC(NC(=O)C(C)CCC)C2)CC1 |
| InChI | InChI=1S/C24H47N3O2/c1-5-8-20(4)24(28)25-22-17-23(18-22)29-16-15-26-11-13-27(14-12-26)19-21(9-6-2)10-7-3/h20-23H,5-19H2,1-4H3,(H,25,28) |
| InChIKey | MEJAGDWBCSVSSM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |