About 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide
4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 170006202) has the molecular formula C9H10F2N4OS
and a molecular weight of 260.27 g/mol. Its IUPAC name is 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide |
| PubChem CID | 170006202 |
| Molecular Formula | C9H10F2N4OS |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)NCC=C(F)F)c(N)n1 |
| InChI | InChI=1S/C9H10F2N4OS/c1-17-9-14-4-5(7(12)15-9)8(16)13-3-2-6(10)11/h2,4H,3H2,1H3,(H,13,16)(H2,12,14,15) |
| InChIKey | MVSIIDLWTBSZSW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide?
The IUPAC name of 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide (CID 170006202) is 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide.
What is the SMILES notation for 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide?
The canonical SMILES for 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide is CSc1ncc(C(=O)NCC=C(F)F)c(N)n1.
What is the InChIKey of 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide?
The InChIKey is MVSIIDLWTBSZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N4OS/c1-17-9-14-4-5(7(12)15-9)8(16)13-3-2-6(10)11/h2,4H,3H2,1H3,(H,13,16)(H2,12,14,15).
What are the key properties of 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide?
4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide has a molecular weight of 260.27 g/mol, XLogP of 1.29, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(3,3-difluoroprop-2-enyl)-2-methylsulfanylpyrimidine-5-carboxamide is sourced from PubChem (CID 170006202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).