C8H15F2NO — CID 170006232
(2R,6R)-4-butan-2-yl-2,6-difluoromorpholine (PubChem CID 170006232) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is (2R,6R)-4-butan-2-yl-2,6-difluoromorpholine.
| Compound Name | (2R,6R)-4-butan-2-yl-2,6-difluoromorpholine |
|---|---|
| PubChem CID | 170006232 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2R,6R)-4-butan-2-yl-2,6-difluoromorpholine |
| SMILES | CCC(C)N1C[C@@H](F)O[C@H](F)C1 |
| InChI | InChI=1S/C8H15F2NO/c1-3-6(2)11-4-7(9)12-8(10)5-11/h6-8H,3-5H2,1-2H3/t6?,7-,8-/m0/s1 |
| InChIKey | ZPZFMNZJDTVPCK-ALKRTJFJSA-N |
| XLogP | 1.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |