C27H26F3N2+ — CID 170006581
N-methyl-8-methylidene-4-phenyl-10-[2-(trifluoromethyl)prop-2-enyl]-7-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-9-amine (PubChem CID 170006581) has the molecular formula C27H26F3N2+ and a molecular weight of 435.51 g/mol. Its IUPAC name is N-methyl-8-methylidene-4-phenyl-10-[2-(trifluoromethyl)prop-2-enyl]-7-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-9-amine.
| Compound Name | N-methyl-8-methylidene-4-phenyl-10-[2-(trifluoromethyl)prop-2-enyl]-7-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-9-amine |
|---|---|
| PubChem CID | 170006581 |
| Molecular Formula | C27H26F3N2+ |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-methyl-8-methylidene-4-phenyl-10-[2-(trifluoromethyl)prop-2-enyl]-7-azoniatricyclo[10.4.0.02,7]hexadeca-1(16),2(7),3,5,12,14-hexaen-9-amine |
| SMILES | C=C1C(NC)C(CC(=C)C(F)(F)F)Cc2ccccc2-c2cc(-c3ccccc3)cc[n+]21 |
| InChI | InChI=1S/C27H26F3N2/c1-18(27(28,29)30)15-23-16-22-11-7-8-12-24(22)25-17-21(20-9-5-4-6-10-20)13-14-32(25)19(2)26(23)31-3/h4-14,17,23,26,31H,1-2,15-16H2,3H3/q+1 |
| InChIKey | ROJBLOLBWVPWFT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|