C24H30FN5O3 — CID 170006947
N-(3-cyclopentylcyclohexyl)-4-[[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]carbamoylamino]pyridine-2-carboxamide (PubChem CID 170006947) has the molecular formula C24H30FN5O3 and a molecular weight of 455.53 g/mol. Its IUPAC name is N-(3-cyclopentylcyclohexyl)-4-[[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]carbamoylamino]pyridine-2-carboxamide.
| Compound Name | N-(3-cyclopentylcyclohexyl)-4-[[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]carbamoylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170006947 |
| Molecular Formula | C24H30FN5O3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-(3-cyclopentylcyclohexyl)-4-[[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]carbamoylamino]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccnc(C(=O)NC2CCCC(C3CCCC3)C2)c1)Nc1cc(F)ncc1CO |
| InChI | InChI=1S/C24H30FN5O3/c25-22-12-20(17(14-31)13-27-22)30-24(33)29-19-8-9-26-21(11-19)23(32)28-18-7-3-6-16(10-18)15-4-1-2-5-15/h8-9,11-13,15-16,18,31H,1-7,10,14H2,(H,28,32)(H2,26,27,29,30,33) |
| InChIKey | YBNGPEWUAKOARJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|