About 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one
9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one (PubChem CID 170007021) has the molecular formula C20H16N2O3
and a molecular weight of 332.36 g/mol. Its IUPAC name is 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one.
Molecular Properties
| Compound Name | 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one |
| PubChem CID | 170007021 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one |
| SMILES | Cc1cc(N)c(N)cc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H16N2O3/c1-10-6-16(21)17(22)9-15(10)20-13-4-2-11(23)7-18(13)25-19-8-12(24)3-5-14(19)20/h2-9,23H,21-22H2,1H3 |
| InChIKey | MJZLTRNXWQJARF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one?
The IUPAC name of 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one (CID 170007021) is 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one.
What is the SMILES notation for 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one?
The canonical SMILES for 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one is Cc1cc(N)c(N)cc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12.
What is the InChIKey of 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one?
The InChIKey is MJZLTRNXWQJARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O3/c1-10-6-16(21)17(22)9-15(10)20-13-4-2-11(23)7-18(13)25-19-8-12(24)3-5-14(19)20/h2-9,23H,21-22H2,1H3.
What are the key properties of 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one?
9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one has a molecular weight of 332.36 g/mol, XLogP of 3.74, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4,5-diamino-2-methylphenyl)-6-hydroxyxanthen-3-one is sourced from PubChem (CID 170007021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).