C12H19NO — CID 170007133
2-[[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxymethyl]prop-2-en-1-amine (PubChem CID 170007133) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxymethyl]prop-2-en-1-amine.
| Compound Name | 2-[[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxymethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 170007133 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxymethyl]prop-2-en-1-amine |
| SMILES | C=C/C(C)=C\C=C(/C)OCC(=C)CN |
| InChI | InChI=1S/C12H19NO/c1-5-10(2)6-7-12(4)14-9-11(3)8-13/h5-7H,1,3,8-9,13H2,2,4H3/b10-6-,12-7+ |
| InChIKey | VSPSXIDMDDICOC-KMJJTFSOSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|