About (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine
(3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine (PubChem CID 170007341) has the molecular formula C18H25N
and a molecular weight of 255.40 g/mol. Its IUPAC name is (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine.
Molecular Properties
| Compound Name | (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine |
| PubChem CID | 170007341 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine |
| SMILES | C=C(C)CC[C@H](NC(=C)c1ccc(C)cc1)C(=C)C |
| InChI | InChI=1S/C18H25N/c1-13(2)7-12-18(14(3)4)19-16(6)17-10-8-15(5)9-11-17/h8-11,18-19H,1,3,6-7,12H2,2,4-5H3/t18-/m0/s1 |
| InChIKey | WDKDALQQKHGUTH-SFHVURJKSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine?
The IUPAC name of (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine (CID 170007341) is (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine.
What is the SMILES notation for (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine?
The canonical SMILES for (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine is C=C(C)CC[C@H](NC(=C)c1ccc(C)cc1)C(=C)C.
What is the InChIKey of (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine?
The InChIKey is WDKDALQQKHGUTH-SFHVURJKSA-N. The full InChI is InChI=1S/C18H25N/c1-13(2)7-12-18(14(3)4)19-16(6)17-10-8-15(5)9-11-17/h8-11,18-19H,1,3,6-7,12H2,2,4-5H3/t18-/m0/s1.
What are the key properties of (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine?
(3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine has a molecular weight of 255.40 g/mol, XLogP of 4.86, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,6-dimethyl-N-[1-(4-methylphenyl)ethenyl]hepta-1,6-dien-3-amine is sourced from PubChem (CID 170007341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).