About 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite
3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite (PubChem CID 170007516) has the molecular formula C14H17IN2O4
and a molecular weight of 404.20 g/mol. Its IUPAC name is 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite.
Molecular Properties
| Compound Name | 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite |
| PubChem CID | 170007516 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite |
| SMILES | O=C1CCC(Nc2ccc(OCCCOI)cc2)C(=O)N1 |
| InChI | InChI=1S/C14H17IN2O4/c15-21-9-1-8-20-11-4-2-10(3-5-11)16-12-6-7-13(18)17-14(12)19/h2-5,12,16H,1,6-9H2,(H,17,18,19) |
| InChIKey | FSLSTTBGUILNTJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite?
The IUPAC name of 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite (CID 170007516) is 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite.
What is the SMILES notation for 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite?
The canonical SMILES for 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite is O=C1CCC(Nc2ccc(OCCCOI)cc2)C(=O)N1.
What is the InChIKey of 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite?
The InChIKey is FSLSTTBGUILNTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17IN2O4/c15-21-9-1-8-20-11-4-2-10(3-5-11)16-12-6-7-13(18)17-14(12)19/h2-5,12,16H,1,6-9H2,(H,17,18,19).
What are the key properties of 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite?
3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite has a molecular weight of 404.20 g/mol, XLogP of 2.04, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,6-dioxopiperidin-3-yl)amino]phenoxy]propyl hypoiodite is sourced from PubChem (CID 170007516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).