C27H29N4O7P — CID 170007519
[4-[(2-benzamido-5-carbamoyl-7-methoxybenzimidazol-1-yl)methyl]phenyl] diethyl phosphate (PubChem CID 170007519) has the molecular formula C27H29N4O7P and a molecular weight of 552.52 g/mol. Its IUPAC name is [4-[(2-benzamido-5-carbamoyl-7-methoxybenzimidazol-1-yl)methyl]phenyl] diethyl phosphate.
| Compound Name | [4-[(2-benzamido-5-carbamoyl-7-methoxybenzimidazol-1-yl)methyl]phenyl] diethyl phosphate |
|---|---|
| PubChem CID | 170007519 |
| Molecular Formula | C27H29N4O7P |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [4-[(2-benzamido-5-carbamoyl-7-methoxybenzimidazol-1-yl)methyl]phenyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1ccc(Cn2c(NC(=O)c3ccccc3)nc3cc(C(N)=O)cc(OC)c32)cc1 |
| InChI | InChI=1S/C27H29N4O7P/c1-4-36-39(34,37-5-2)38-21-13-11-18(12-14-21)17-31-24-22(15-20(25(28)32)16-23(24)35-3)29-27(31)30-26(33)19-9-7-6-8-10-19/h6-16H,4-5,17H2,1-3H3,(H2,28,32)(H,29,30,33) |
| InChIKey | OBKHJOLTVJNDAO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|