C25H22N6O2 — CID 170007745
5-(2-formamido-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1-methyl-N-(1-phenylethyl)indole-3-carboxamide (PubChem CID 170007745) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 5-(2-formamido-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1-methyl-N-(1-phenylethyl)indole-3-carboxamide.
| Compound Name | 5-(2-formamido-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1-methyl-N-(1-phenylethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 170007745 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 5-(2-formamido-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1-methyl-N-(1-phenylethyl)indole-3-carboxamide |
| SMILES | CC(NC(=O)c1cn(C)c2ccc(-c3ccn4nc(NC=O)nc4c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C25H22N6O2/c1-16(17-6-4-3-5-7-17)27-24(33)21-14-30(2)22-9-8-18(12-20(21)22)19-10-11-31-23(13-19)28-25(29-31)26-15-32/h3-16H,1-2H3,(H,27,33)(H,26,29,32) |
| InChIKey | FRSSCVGSEJDNGA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|